|
|
|
|
|
|
|
|
|
|
|
|
|
|
 |
Chemistry question?
|
|
Suggestion?
Contact webmaster
|
|
WebQC.Org
online education
free homework help
chemistry problems questions and answers
|
2004-2008
© Vitalii Vanovschi
All rights reserved
|
|
Enter a chemical formula of a compound to calculate its molar mass and elemental composition:
|
|
|
Molar mass (molecular weight) of Os2H7(P(C6H5)(C3H7)2)4HC(SO2CF3)2 is 1443.6975 g/mol
Elemental composition of Os2H7(P(C6H5)(C3H7)2)4HC(SO2CF3)2:
| Symbol | Element | Atomic weight | Number of atoms | Mass percent |
|---|
| Os | Osmium | 190.233 | 2 | 26.3536 % | | H | Hydrogen | 1.007947 | 84 | 5.8646 % | | C | Carbon | 12.01078 | 51 | 42.4292 % | | S | Sulfur | 32.0655 | 2 | 4.4421 % | | O | Oxygen | 15.99943 | 4 | 4.4329 % | | F | Fluorine | 18.99840325 | 6 | 7.8957 % | | P | Phosphorus | 30.9737622 | 4 | 8.5818 % | Please tell about this free chemistry software to your friends!
|
Instructions to calculate molar mass (molecular weight) of a chemical compound:
- To calculate molar mass of a chemical compound enter it's formula and click 'Calculate!'
- In chemical formula you may use:
- Any chemical element
- Functional groups: Ph, Me, Et, Pr, Bu, Ac, For, Ts, Tos, Bz, TMS, tBu, Bzl, Bn
- parantesis () or brackets []
- Next values are numerically equivalent: molar mass, molecular mass, molar weight, molecular weight
Defentitions of molecular mass, molecular weight, molar mass and molar weight:
-
Molecular mass (molecular weight) is the mass of one molecule of a substance and is expressed in the unified atomic mass units (u). (1 u is equal to 1/12 the mass of one atom of carbon-12)
- Molar mass (molar weight) is the mass of one mole of a substance and is expressed in g/mol.
Give us feedback about you experience with Molecular Weight Calculator.
Related: Molecular weights of amino acids
molecular weights calculated today
|
|